About (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol
(2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol (PubChem CID 7374973) has the molecular formula C17H15BrO4
and a molecular weight of 363.21 g/mol. Its IUPAC name is (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol.
Molecular Properties
| Compound Name | (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol |
| PubChem CID | 7374973 |
| Molecular Formula | C17H15BrO4 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol |
| SMILES | COc1cc(Br)c(/C=C2\Oc3ccccc3[C@H]2O)cc1OC |
| InChI | InChI=1S/C17H15BrO4/c1-20-14-7-10(12(18)9-15(14)21-2)8-16-17(19)11-5-3-4-6-13(11)22-16/h3-9,17,19H,1-2H3/b16-8-/t17-/m1/s1 |
| InChIKey | WHGSFZMKLCWXDR-QOTSWMAJSA-N |
| XLogP | 3.93 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol?
The IUPAC name of (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol (CID 7374973) is (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol.
What is the SMILES notation for (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol?
The canonical SMILES for (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol is COc1cc(Br)c(/C=C2\Oc3ccccc3[C@H]2O)cc1OC.
What is the InChIKey of (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol?
The InChIKey is WHGSFZMKLCWXDR-QOTSWMAJSA-N. The full InChI is InChI=1S/C17H15BrO4/c1-20-14-7-10(12(18)9-15(14)21-2)8-16-17(19)11-5-3-4-6-13(11)22-16/h3-9,17,19H,1-2H3/b16-8-/t17-/m1/s1.
What are the key properties of (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol?
(2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol has a molecular weight of 363.21 g/mol, XLogP of 3.93, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,3R)-2-[(2-bromo-4,5-dimethoxyphenyl)methylidene]-3H-1-benzofuran-3-ol is sourced from PubChem (CID 7374973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).