About (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium
(2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium (PubChem CID 7375754) has the molecular formula C19H28NO+
and a molecular weight of 286.44 g/mol. Its IUPAC name is (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium.
Molecular Properties
| Compound Name | (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium |
| PubChem CID | 7375754 |
| Molecular Formula | C19H28NO+ |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.22 |
| IUPAC Name | (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium |
| SMILES | Oc1ccccc1C[NH2+]CC12CC3C[C@@H](CC[C@@H](C3)C1)C2 |
| InChI | InChI=1S/C19H27NO/c21-18-4-2-1-3-17(18)12-20-13-19-9-14-5-6-15(10-19)8-16(7-14)11-19/h1-4,14-16,20-21H,5-13H2/p+1/t14-,15+,16?,19? |
| InChIKey | JSGYFGDVUVUJIX-JOUKPKRSSA-O |
| XLogP | 3.06 |
| TPSA | 36.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium?
The IUPAC name of (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium (CID 7375754) is (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium.
What is the SMILES notation for (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium?
The canonical SMILES for (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium is Oc1ccccc1C[NH2+]CC12CC3C[C@@H](CC[C@@H](C3)C1)C2.
What is the InChIKey of (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium?
The InChIKey is JSGYFGDVUVUJIX-JOUKPKRSSA-O. The full InChI is InChI=1S/C19H27NO/c21-18-4-2-1-3-17(18)12-20-13-19-9-14-5-6-15(10-19)8-16(7-14)11-19/h1-4,14-16,20-21H,5-13H2/p+1/t14-,15+,16?,19?.
What are the key properties of (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium?
(2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium has a molecular weight of 286.44 g/mol, XLogP of 3.06, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxyphenyl)methyl-[[(3S,6R)-1-tricyclo[4.3.1.13,8]undecanyl]methyl]azanium is sourced from PubChem (CID 7375754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).