C18H22N2O4 — CID 7375866
3-nitro-4-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]chromen-2-one (PubChem CID 7375866) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-nitro-4-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]chromen-2-one.
| Compound Name | 3-nitro-4-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]chromen-2-one |
|---|---|
| PubChem CID | 7375866 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 3-nitro-4-[[(1R,5S)-3,3,5-trimethylcyclohexyl]amino]chromen-2-one |
| SMILES | C[C@@H]1C[C@@H](Nc2c([N+](=O)[O-])c(=O)oc3ccccc23)CC(C)(C)C1 |
| InChI | InChI=1S/C18H22N2O4/c1-11-8-12(10-18(2,3)9-11)19-15-13-6-4-5-7-14(13)24-17(21)16(15)20(22)23/h4-7,11-12,19H,8-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | XXFBVGMMIROTHC-VXGBXAGGSA-N |
| XLogP | 4.33 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|