About 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol
4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol (PubChem CID 737588) has the molecular formula C17H12N2OS
and a molecular weight of 292.36 g/mol. Its IUPAC name is 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol |
| PubChem CID | 737588 |
| Molecular Formula | C17H12N2OS |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol |
| SMILES | Oc1ccc(-c2nc(-c3c[nH]c4ccccc34)cs2)cc1 |
| InChI | InChI=1S/C17H12N2OS/c20-12-7-5-11(6-8-12)17-19-16(10-21-17)14-9-18-15-4-2-1-3-13(14)15/h1-10,18,20H |
| InChIKey | GKUHULKDFFMLAW-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol?
The IUPAC name of 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol (CID 737588) is 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol.
What is the SMILES notation for 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol?
The canonical SMILES for 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol is Oc1ccc(-c2nc(-c3c[nH]c4ccccc34)cs2)cc1.
What is the InChIKey of 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol?
The InChIKey is GKUHULKDFFMLAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12N2OS/c20-12-7-5-11(6-8-12)17-19-16(10-21-17)14-9-18-15-4-2-1-3-13(14)15/h1-10,18,20H.
What are the key properties of 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol?
4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol has a molecular weight of 292.36 g/mol, XLogP of 4.66, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(1H-indol-3-yl)-1,3-thiazol-2-yl]phenol is sourced from PubChem (CID 737588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).