C17H18BrNO2 — CID 7376118
(2S)-2-(4-bromophenoxy)-N-(2,5-dimethylphenyl)propanamide (PubChem CID 7376118) has the molecular formula C17H18BrNO2 and a molecular weight of 348.24 g/mol. Its IUPAC name is (2S)-2-(4-bromophenoxy)-N-(2,5-dimethylphenyl)propanamide.
| Compound Name | (2S)-2-(4-bromophenoxy)-N-(2,5-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 7376118 |
| Molecular Formula | C17H18BrNO2 |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (2S)-2-(4-bromophenoxy)-N-(2,5-dimethylphenyl)propanamide |
| SMILES | Cc1ccc(C)c(NC(=O)[C@H](C)Oc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C17H18BrNO2/c1-11-4-5-12(2)16(10-11)19-17(20)13(3)21-15-8-6-14(18)7-9-15/h4-10,13H,1-3H3,(H,19,20)/t13-/m0/s1 |
| InChIKey | KLOMBRLHPDMKLW-ZDUSSCGKSA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |