C16H23NO9 — CID 7376344
3a-O,5-O-diethyl 2-O-methyl (2R,3aS,4R,5S)-4-(2-oxopropyl)-2,3,4,5-tetrahydro-[1,2]oxazolo[2,3-b][1,2]oxazole-2,3a,5-tricarboxylate (PubChem CID 7376344) has the molecular formula C16H23NO9 and a molecular weight of 373.36 g/mol. Its IUPAC name is 3a-O,5-O-diethyl 2-O-methyl (2R,3aS,4R,5S)-4-(2-oxopropyl)-2,3,4,5-tetrahydro-[1,2]oxazolo[2,3-b][1,2]oxazole-2,3a,5-tricarboxylate.
| Compound Name | 3a-O,5-O-diethyl 2-O-methyl (2R,3aS,4R,5S)-4-(2-oxopropyl)-2,3,4,5-tetrahydro-[1,2]oxazolo[2,3-b][1,2]oxazole-2,3a,5-tricarboxylate |
|---|---|
| PubChem CID | 7376344 |
| Molecular Formula | C16H23NO9 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 3a-O,5-O-diethyl 2-O-methyl (2R,3aS,4R,5S)-4-(2-oxopropyl)-2,3,4,5-tetrahydro-[1,2]oxazolo[2,3-b][1,2]oxazole-2,3a,5-tricarboxylate |
| SMILES | CCOC(=O)[C@H]1ON2O[C@@H](C(=O)OC)C[C@@]2(C(=O)OCC)[C@H]1CC(C)=O |
| InChI | InChI=1S/C16H23NO9/c1-5-23-14(20)12-10(7-9(3)18)16(15(21)24-6-2)8-11(13(19)22-4)25-17(16)26-12/h10-12H,5-8H2,1-4H3/t10-,11+,12-,16-/m0/s1 |
| InChIKey | PBEXUCOCTXUUFC-BUWBCJGYSA-N |
| XLogP | -0.06 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|