C21H22ClN3O3 — CID 7376486
2-(1-adamantyl)-5-(1,3-benzodioxol-5-ylamino)-4-chloropyridazin-3-one (PubChem CID 7376486) has the molecular formula C21H22ClN3O3 and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-(1-adamantyl)-5-(1,3-benzodioxol-5-ylamino)-4-chloropyridazin-3-one.
| Compound Name | 2-(1-adamantyl)-5-(1,3-benzodioxol-5-ylamino)-4-chloropyridazin-3-one |
|---|---|
| PubChem CID | 7376486 |
| Molecular Formula | C21H22ClN3O3 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(1-adamantyl)-5-(1,3-benzodioxol-5-ylamino)-4-chloropyridazin-3-one |
| SMILES | O=c1c(Cl)c(Nc2ccc3c(c2)OCO3)cnn1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H22ClN3O3/c22-19-16(24-15-1-2-17-18(6-15)28-11-27-17)10-23-25(20(19)26)21-7-12-3-13(8-21)5-14(4-12)9-21/h1-2,6,10,12-14,24H,3-5,7-9,11H2 |
| InChIKey | OKUOCPUOQMNGEV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |