C19H21NO3S2 — CID 7377168
2-benzylsulfanyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide (PubChem CID 7377168) has the molecular formula C19H21NO3S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide.
| Compound Name | 2-benzylsulfanyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 7377168 |
| Molecular Formula | C19H21NO3S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | 2-benzylsulfanyl-N-[(3R)-1,1-dioxothiolan-3-yl]-N-phenylacetamide |
| SMILES | O=C(CSCc1ccccc1)N(c1ccccc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C19H21NO3S2/c21-19(14-24-13-16-7-3-1-4-8-16)20(17-9-5-2-6-10-17)18-11-12-25(22,23)15-18/h1-10,18H,11-15H2/t18-/m1/s1 |
| InChIKey | SILCDJUCUIJDQE-GOSISDBHSA-N |
| XLogP | 3.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |