About (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile
(7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile (PubChem CID 7378440) has the molecular formula C19H15N5O
and a molecular weight of 329.36 g/mol. Its IUPAC name is (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile.
Molecular Properties
| Compound Name | (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile |
| PubChem CID | 7378440 |
| Molecular Formula | C19H15N5O |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile |
| SMILES | Cc1nc2c(o1)N(c1cccnc1)C(N)=C(C#N)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C19H15N5O/c1-12-23-17-16(13-6-3-2-4-7-13)15(10-20)18(21)24(19(17)25-12)14-8-5-9-22-11-14/h2-9,11,16H,21H2,1H3/t16-/m1/s1 |
| InChIKey | ZKVLUEROZWDEQG-MRXNPFEDSA-N |
| XLogP | 3.36 |
| TPSA | 91.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile?
The IUPAC name of (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile (CID 7378440) is (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile.
What is the SMILES notation for (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile?
The canonical SMILES for (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile is Cc1nc2c(o1)N(c1cccnc1)C(N)=C(C#N)[C@H]2c1ccccc1.
What is the InChIKey of (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile?
The InChIKey is ZKVLUEROZWDEQG-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H15N5O/c1-12-23-17-16(13-6-3-2-4-7-13)15(10-20)18(21)24(19(17)25-12)14-8-5-9-22-11-14/h2-9,11,16H,21H2,1H3/t16-/m1/s1.
What are the key properties of (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile?
(7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile has a molecular weight of 329.36 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-5-amino-2-methyl-7-phenyl-4-pyridin-3-yl-7H-[1,3]oxazolo[5,4-b]pyridine-6-carbonitrile is sourced from PubChem (CID 7378440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).