About [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate
[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate (PubChem CID 7378652) has the molecular formula C19H18ClFN2O3
and a molecular weight of 376.82 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate |
| PubChem CID | 7378652 |
| Molecular Formula | C19H18ClFN2O3 |
| Molecular Weight | 376.82 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate |
| SMILES | O=C(OCC(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H18ClFN2O3/c20-15-3-1-14(2-4-15)19(25)26-13-18(24)23-11-9-22(10-12-23)17-7-5-16(21)6-8-17/h1-8H,9-13H2 |
| InChIKey | AUGZOUJQVWNXSB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.82 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate?
The IUPAC name of [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate (CID 7378652) is [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate.
What is the SMILES notation for [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate?
The canonical SMILES for [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate is O=C(OCC(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccc(Cl)cc1.
What is the InChIKey of [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate?
The InChIKey is AUGZOUJQVWNXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18ClFN2O3/c20-15-3-1-14(2-4-15)19(25)26-13-18(24)23-11-9-22(10-12-23)17-7-5-16(21)6-8-17/h1-8H,9-13H2.
What are the key properties of [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate?
[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate has a molecular weight of 376.82 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 4-chlorobenzoate is sourced from PubChem (CID 7378652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).