About 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide
4-methyl-2-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 737887) has the molecular formula C11H10N2OS
and a molecular weight of 218.28 g/mol. Its IUPAC name is 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 737887 |
| Molecular Formula | C11H10N2OS |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1C(N)=O |
| InChI | InChI=1S/C11H10N2OS/c1-7-9(10(12)14)15-11(13-7)8-5-3-2-4-6-8/h2-6H,1H3,(H2,12,14) |
| InChIKey | HGWKKGLUWKNUOF-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide (CID 737887) is 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide is Cc1nc(-c2ccccc2)sc1C(N)=O.
What is the InChIKey of 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide?
The InChIKey is HGWKKGLUWKNUOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2OS/c1-7-9(10(12)14)15-11(13-7)8-5-3-2-4-6-8/h2-6H,1H3,(H2,12,14).
What are the key properties of 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide?
4-methyl-2-phenyl-1,3-thiazole-5-carboxamide has a molecular weight of 218.28 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2-phenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 737887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).