C16H18N2O2 — CID 7379116
(4S)-3-amino-4-[(1R)-cyclohex-3-en-1-yl]-4,6,7,8-tetrahydroindeno[2,1-d][1,2]oxazol-5-one (PubChem CID 7379116) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is (4S)-3-amino-4-[(1R)-cyclohex-3-en-1-yl]-4,6,7,8-tetrahydroindeno[2,1-d][1,2]oxazol-5-one.
| Compound Name | (4S)-3-amino-4-[(1R)-cyclohex-3-en-1-yl]-4,6,7,8-tetrahydroindeno[2,1-d][1,2]oxazol-5-one |
|---|---|
| PubChem CID | 7379116 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (4S)-3-amino-4-[(1R)-cyclohex-3-en-1-yl]-4,6,7,8-tetrahydroindeno[2,1-d][1,2]oxazol-5-one |
| SMILES | Nc1noc2c1[C@H]([C@H]1CC=CCC1)C1=C2CCCC1=O |
| InChI | InChI=1S/C16H18N2O2/c17-16-14-12(9-5-2-1-3-6-9)13-10(15(14)20-18-16)7-4-8-11(13)19/h1-2,9,12H,3-8H2,(H2,17,18)/t9-,12+/m0/s1 |
| InChIKey | TUAKHGIXAHVRNO-JOYOIKCWSA-N |
| XLogP | 3.22 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|