About 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid
2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 738083) has the molecular formula C12H11NO3S
and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 738083 |
| Molecular Formula | C12H11NO3S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid |
| SMILES | COc1ccc(-c2nc(CC(=O)O)cs2)cc1 |
| InChI | InChI=1S/C12H11NO3S/c1-16-10-4-2-8(3-5-10)12-13-9(7-17-12)6-11(14)15/h2-5,7H,6H2,1H3,(H,14,15) |
| InChIKey | HWRQFRXTBPYUEK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid (CID 738083) is 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid is COc1ccc(-c2nc(CC(=O)O)cs2)cc1.
What is the InChIKey of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is HWRQFRXTBPYUEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3S/c1-16-10-4-2-8(3-5-10)12-13-9(7-17-12)6-11(14)15/h2-5,7H,6H2,1H3,(H,14,15).
What are the key properties of 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 249.29 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-methoxyphenyl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 738083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).