C14H28N+ — CID 7380900
2-methylpropyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium (PubChem CID 7380900) has the molecular formula C14H28N+ and a molecular weight of 210.38 g/mol. Its IUPAC name is 2-methylpropyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium.
| Compound Name | 2-methylpropyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 7380900 |
| Molecular Formula | C14H28N+ |
| Molecular Weight | 210.38 g/mol |
| Exact Mass | 210.22 |
| IUPAC Name | 2-methylpropyl-[[(1S,2S,6R)-2,4,6-trimethylcyclohex-3-en-1-yl]methyl]azanium |
| SMILES | CC1=C[C@H](C)[C@@H](C[NH2+]CC(C)C)[C@H](C)C1 |
| InChI | InChI=1S/C14H27N/c1-10(2)8-15-9-14-12(4)6-11(3)7-13(14)5/h6,10,12-15H,7-9H2,1-5H3/p+1/t12-,13+,14+/m0/s1 |
| InChIKey | LYDDCMLXSZPXMZ-BFHYXJOUSA-O |
| XLogP | 2.44 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|