About 3-hydroxypyrido[1,2-a]indole-10-carbonitrile
3-hydroxypyrido[1,2-a]indole-10-carbonitrile (PubChem CID 738092) has the molecular formula C13H8N2O
and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-hydroxypyrido[1,2-a]indole-10-carbonitrile.
Molecular Properties
| Compound Name | 3-hydroxypyrido[1,2-a]indole-10-carbonitrile |
| PubChem CID | 738092 |
| Molecular Formula | C13H8N2O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-hydroxypyrido[1,2-a]indole-10-carbonitrile |
| SMILES | N#Cc1c2ccc(O)cc2n2ccccc12 |
| InChI | InChI=1S/C13H8N2O/c14-8-11-10-5-4-9(16)7-13(10)15-6-2-1-3-12(11)15/h1-7,16H |
| InChIKey | OPRUTASSYAGEDI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-hydroxypyrido[1,2-a]indole-10-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxypyrido[1,2-a]indole-10-carbonitrile?
The IUPAC name of 3-hydroxypyrido[1,2-a]indole-10-carbonitrile (CID 738092) is 3-hydroxypyrido[1,2-a]indole-10-carbonitrile.
What is the SMILES notation for 3-hydroxypyrido[1,2-a]indole-10-carbonitrile?
The canonical SMILES for 3-hydroxypyrido[1,2-a]indole-10-carbonitrile is N#Cc1c2ccc(O)cc2n2ccccc12.
What is the InChIKey of 3-hydroxypyrido[1,2-a]indole-10-carbonitrile?
The InChIKey is OPRUTASSYAGEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O/c14-8-11-10-5-4-9(16)7-13(10)15-6-2-1-3-12(11)15/h1-7,16H.
What are the key properties of 3-hydroxypyrido[1,2-a]indole-10-carbonitrile?
3-hydroxypyrido[1,2-a]indole-10-carbonitrile has a molecular weight of 208.22 g/mol, XLogP of 2.67, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxypyrido[1,2-a]indole-10-carbonitrile is sourced from PubChem (CID 738092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).