C18H17ClN2O3S — CID 7381114
2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carbonitrile (PubChem CID 7381114) has the molecular formula C18H17ClN2O3S and a molecular weight of 376.87 g/mol. Its IUPAC name is 2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carbonitrile.
| Compound Name | 2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carbonitrile |
|---|---|
| PubChem CID | 7381114 |
| Molecular Formula | C18H17ClN2O3S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-[(3aR,7aR)-5-chloro-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-5,5-dimethyl-4,7-dihydrothieno[2,3-c]pyran-3-carbonitrile |
| SMILES | CC1(C)Cc2c(sc(N3C(=O)[C@@H]4CC=C(Cl)C[C@H]4C3=O)c2C#N)CO1 |
| InChI | InChI=1S/C18H17ClN2O3S/c1-18(2)6-12-13(7-20)17(25-14(12)8-24-18)21-15(22)10-4-3-9(19)5-11(10)16(21)23/h3,10-11H,4-6,8H2,1-2H3/t10-,11-/m1/s1 |
| InChIKey | MTJOQIVGYKHLFQ-GHMZBOCLSA-N |
| XLogP | 3.49 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|