C18H15NO5-2 — CID 7381701
4-[[(3S)-4-carboxylato-3-phenylbutanoyl]amino]benzoate (PubChem CID 7381701) has the molecular formula C18H15NO5-2 and a molecular weight of 325.32 g/mol. Its IUPAC name is 4-[[(3S)-4-carboxylato-3-phenylbutanoyl]amino]benzoate.
| Compound Name | 4-[[(3S)-4-carboxylato-3-phenylbutanoyl]amino]benzoate |
|---|---|
| PubChem CID | 7381701 |
| Molecular Formula | C18H15NO5-2 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 4-[[(3S)-4-carboxylato-3-phenylbutanoyl]amino]benzoate |
| SMILES | O=C([O-])C[C@H](CC(=O)Nc1ccc(C(=O)[O-])cc1)c1ccccc1 |
| InChI | InChI=1S/C18H17NO5/c20-16(19-15-8-6-13(7-9-15)18(23)24)10-14(11-17(21)22)12-4-2-1-3-5-12/h1-9,14H,10-11H2,(H,19,20)(H,21,22)(H,23,24)/p-2/t14-/m0/s1 |
| InChIKey | VCTGFTXIGXBBLH-AWEZNQCLSA-L |
| XLogP | 0.30 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |