About 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one
2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 7382212) has the molecular formula C15H13NO3S
and a molecular weight of 287.34 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| PubChem CID | 7382212 |
| Molecular Formula | C15H13NO3S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | Cc1ccc(CN2C(=O)c3ccccc3S2(=O)=O)cc1 |
| InChI | InChI=1S/C15H13NO3S/c1-11-6-8-12(9-7-11)10-16-15(17)13-4-2-3-5-14(13)20(16,18)19/h2-9H,10H2,1H3 |
| InChIKey | KPSNSIQILVDOIA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The IUPAC name of 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one (CID 7382212) is 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one.
What is the SMILES notation for 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The canonical SMILES for 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one is Cc1ccc(CN2C(=O)c3ccccc3S2(=O)=O)cc1.
What is the InChIKey of 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
The InChIKey is KPSNSIQILVDOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO3S/c1-11-6-8-12(9-7-11)10-16-15(17)13-4-2-3-5-14(13)20(16,18)19/h2-9H,10H2,1H3.
What are the key properties of 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one?
2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one has a molecular weight of 287.34 g/mol, XLogP of 2.34, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methylphenyl)methyl]-1,1-dioxo-1,2-benzothiazol-3-one is sourced from PubChem (CID 7382212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).