C10H18O — CID 73822230
3,3-Dimethylbicyclo[2.2.2]octan-2-ol (PubChem CID 73822230) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is 3,3-dimethylbicyclo[2.2.2]octan-2-ol.
| Compound Name | 3,3-Dimethylbicyclo[2.2.2]octan-2-ol |
|---|---|
| PubChem CID | 73822230 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 3,3-dimethylbicyclo[2.2.2]octan-2-ol |
| SMILES | CC1(C2CCC(C1O)CC2)C |
| InChI | InChI=1S/C10H18O/c1-10(2)8-5-3-7(4-6-8)9(10)11/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | CUFYUIRJALRNKZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | 154 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |