C23H20N2O5 — CID 7382290
[2-(2-benzylanilino)-2-oxoethyl] 2-methyl-3-nitrobenzoate (PubChem CID 7382290) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-(2-benzylanilino)-2-oxoethyl] 2-methyl-3-nitrobenzoate.
| Compound Name | [2-(2-benzylanilino)-2-oxoethyl] 2-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7382290 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [2-(2-benzylanilino)-2-oxoethyl] 2-methyl-3-nitrobenzoate |
| SMILES | Cc1c(C(=O)OCC(=O)Nc2ccccc2Cc2ccccc2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H20N2O5/c1-16-19(11-7-13-21(16)25(28)29)23(27)30-15-22(26)24-20-12-6-5-10-18(20)14-17-8-3-2-4-9-17/h2-13H,14-15H2,1H3,(H,24,26) |
| InChIKey | PVGHIRNFMWVOMX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|