C13H27NO2 — CID 738468
N,N,2-trimethyl-2-[(2S,6R)-4,4,6-trimethyl-1,3-dioxan-2-yl]propan-1-amine (PubChem CID 738468) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N,N,2-trimethyl-2-[(2S,6R)-4,4,6-trimethyl-1,3-dioxan-2-yl]propan-1-amine.
| Compound Name | N,N,2-trimethyl-2-[(2S,6R)-4,4,6-trimethyl-1,3-dioxan-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 738468 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N,N,2-trimethyl-2-[(2S,6R)-4,4,6-trimethyl-1,3-dioxan-2-yl]propan-1-amine |
| SMILES | C[C@@H]1CC(C)(C)O[C@@H](C(C)(C)CN(C)C)O1 |
| InChI | InChI=1S/C13H27NO2/c1-10-8-13(4,5)16-11(15-10)12(2,3)9-14(6)7/h10-11H,8-9H2,1-7H3/t10-,11+/m1/s1 |
| InChIKey | ISIJXVZVUKMGND-MNOVXSKESA-N |
| XLogP | 2.50 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |