C18H23N5O3S2 — CID 7385289
2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide (PubChem CID 7385289) has the molecular formula C18H23N5O3S2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 7385289 |
| Molecular Formula | C18H23N5O3S2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | 2-[[5-(cyclohexylcarbamoylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CSc1nnc(NC(=O)NC2CCCCC2)s1 |
| InChI | InChI=1S/C18H23N5O3S2/c1-26-14-10-6-5-9-13(14)20-15(24)11-27-18-23-22-17(28-18)21-16(25)19-12-7-3-2-4-8-12/h5-6,9-10,12H,2-4,7-8,11H2,1H3,(H,20,24)(H2,19,21,22,25) |
| InChIKey | KMMFXHMNNZFIEH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|