About N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide
N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide (PubChem CID 7385665) has the molecular formula C11H12BrN3OS
and a molecular weight of 314.21 g/mol. Its IUPAC name is N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide.
Molecular Properties
| Compound Name | N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide |
| PubChem CID | 7385665 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide |
| SMILES | O=C(NNC1=NC[C@H](CBr)S1)c1ccccc1 |
| InChI | InChI=1S/C11H12BrN3OS/c12-6-9-7-13-11(17-9)15-14-10(16)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,15)(H,14,16)/t9-/m0/s1 |
| InChIKey | SGJLWGOLCZQSFZ-VIFPVBQESA-N |
| XLogP | 1.79 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide?
The IUPAC name of N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide (CID 7385665) is N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide.
What is the SMILES notation for N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide?
The canonical SMILES for N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide is O=C(NNC1=NC[C@H](CBr)S1)c1ccccc1.
What is the InChIKey of N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide?
The InChIKey is SGJLWGOLCZQSFZ-VIFPVBQESA-N. The full InChI is InChI=1S/C11H12BrN3OS/c12-6-9-7-13-11(17-9)15-14-10(16)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,15)(H,14,16)/t9-/m0/s1.
What are the key properties of N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide?
N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide has a molecular weight of 314.21 g/mol, XLogP of 1.79, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(5R)-5-(bromomethyl)-4,5-dihydro-1,3-thiazol-2-yl]benzohydrazide is sourced from PubChem (CID 7385665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).