C15H12ClN5OS — CID 738629
N-(4-chlorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide (PubChem CID 738629) has the molecular formula C15H12ClN5OS and a molecular weight of 345.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-(4-chlorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 738629 |
| Molecular Formula | C15H12ClN5OS |
| Molecular Weight | 345.82 g/mol |
| Exact Mass | 345.05 |
| IUPAC Name | N-(4-chlorophenyl)-2-(1-phenyltetrazol-5-yl)sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1-c1ccccc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12ClN5OS/c16-11-6-8-12(9-7-11)17-14(22)10-23-15-18-19-20-21(15)13-4-2-1-3-5-13/h1-9H,10H2,(H,17,22) |
| InChIKey | ZMKCYYVZGKAMSA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.82 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |