C20H16F2N2O4 — CID 7386802
ethyl 1-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-6-oxopyridazine-3-carboxylate (PubChem CID 7386802) has the molecular formula C20H16F2N2O4 and a molecular weight of 386.35 g/mol. Its IUPAC name is ethyl 1-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-6-oxopyridazine-3-carboxylate.
| Compound Name | ethyl 1-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 7386802 |
| Molecular Formula | C20H16F2N2O4 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | ethyl 1-(4-fluorophenyl)-4-[(2-fluorophenyl)methoxy]-6-oxopyridazine-3-carboxylate |
| SMILES | CCOC(=O)c1nn(-c2ccc(F)cc2)c(=O)cc1OCc1ccccc1F |
| InChI | InChI=1S/C20H16F2N2O4/c1-2-27-20(26)19-17(28-12-13-5-3-4-6-16(13)22)11-18(25)24(23-19)15-9-7-14(21)8-10-15/h3-11H,2,12H2,1H3 |
| InChIKey | TVQQSYAMYULKLI-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |