C19H29ClN6O — CID 7388179
1-(5-chloro-2-methylphenyl)-4-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]butyl]piperazine (PubChem CID 7388179) has the molecular formula C19H29ClN6O and a molecular weight of 392.94 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-4-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-4-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 7388179 |
| Molecular Formula | C19H29ClN6O |
| Molecular Weight | 392.94 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-4-[(1S)-1-[1-(2-methoxyethyl)tetrazol-5-yl]butyl]piperazine |
| SMILES | CCC[C@@H](c1nnnn1CCOC)N1CCN(c2cc(Cl)ccc2C)CC1 |
| InChI | InChI=1S/C19H29ClN6O/c1-4-5-17(19-21-22-23-26(19)12-13-27-3)24-8-10-25(11-9-24)18-14-16(20)7-6-15(18)2/h6-7,14,17H,4-5,8-13H2,1-3H3/t17-/m0/s1 |
| InChIKey | PDDYNICXSSVTRZ-KRWDZBQOSA-N |
| XLogP | 2.94 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.94 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |