C24H27NO3 — CID 7388195
(5S)-1-hexyl-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 7388195) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is (5S)-1-hexyl-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (5S)-1-hexyl-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 7388195 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (5S)-1-hexyl-4-[hydroxy(phenyl)methylidene]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCCN1C(=O)C(=O)C(=C(O)c2ccccc2)[C@@H]1c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27NO3/c1-3-4-5-9-16-25-21(18-14-12-17(2)13-15-18)20(23(27)24(25)28)22(26)19-10-7-6-8-11-19/h6-8,10-15,21,26H,3-5,9,16H2,1-2H3/t21-/m0/s1 |
| InChIKey | GYPXUPXSJYMEGA-NRFANRHFSA-N |
| XLogP | 5.00 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|