C20H30N4O2 — CID 7390265
2-[(1S,5R)-3-acetamido-9-azabicyclo[3.3.1]nonan-9-yl]-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 7390265) has the molecular formula C20H30N4O2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 2-[(1S,5R)-3-acetamido-9-azabicyclo[3.3.1]nonan-9-yl]-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-[(1S,5R)-3-acetamido-9-azabicyclo[3.3.1]nonan-9-yl]-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 7390265 |
| Molecular Formula | C20H30N4O2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.24 |
| IUPAC Name | 2-[(1S,5R)-3-acetamido-9-azabicyclo[3.3.1]nonan-9-yl]-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | CC(=O)NC1C[C@H]2CCC[C@@H](C1)N2CC(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H30N4O2/c1-14(25)21-16-11-18-5-4-6-19(12-16)24(18)13-20(26)22-15-7-9-17(10-8-15)23(2)3/h7-10,16,18-19H,4-6,11-13H2,1-3H3,(H,21,25)(H,22,26)/t16?,18-,19+ |
| InChIKey | NNQGVLAFGABBSC-JLYLLQBASA-N |
| XLogP | 2.21 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|