C24H26N5S+ — CID 7390320
4-(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)-N-phenyl-1,4-diazepane-1-carbothioamide (PubChem CID 7390320) has the molecular formula C24H26N5S+ and a molecular weight of 416.57 g/mol. Its IUPAC name is 4-(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)-N-phenyl-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)-N-phenyl-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 7390320 |
| Molecular Formula | C24H26N5S+ |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 4-(3-cyano-5,7-dimethylquinolin-1-ium-2-yl)-N-phenyl-1,4-diazepane-1-carbothioamide |
| SMILES | Cc1cc(C)c2cc(C#N)c(N3CCCN(C(=S)Nc4ccccc4)CC3)[nH+]c2c1 |
| InChI | InChI=1S/C24H25N5S/c1-17-13-18(2)21-15-19(16-25)23(27-22(21)14-17)28-9-6-10-29(12-11-28)24(30)26-20-7-4-3-5-8-20/h3-5,7-8,13-15H,6,9-12H2,1-2H3,(H,26,30)/p+1 |
| InChIKey | BCRJSLGBCFZXGC-UHFFFAOYSA-O |
| XLogP | 4.05 |
| TPSA | 56.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|