C20H27N3O2S2 — CID 7391272
(7R)-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one (PubChem CID 7391272) has the molecular formula C20H27N3O2S2 and a molecular weight of 405.59 g/mol. Its IUPAC name is (7R)-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one.
| Compound Name | (7R)-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 7391272 |
| Molecular Formula | C20H27N3O2S2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | (7R)-2-[2-[(2R,6R)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]sulfanyl-7-methyl-5,6,7,8-tetrahydro-3H-[1]benzothiolo[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@H]1CCc2c(sc3nc(SCC(=O)N4[C@H](C)CCC[C@H]4C)[nH]c(=O)c23)C1 |
| InChI | InChI=1S/C20H27N3O2S2/c1-11-7-8-14-15(9-11)27-19-17(14)18(25)21-20(22-19)26-10-16(24)23-12(2)5-4-6-13(23)3/h11-13H,4-10H2,1-3H3,(H,21,22,25)/t11-,12-,13-/m1/s1 |
| InChIKey | HKCPZFHKULUUNV-JHJVBQTASA-N |
| XLogP | 3.99 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |