C18H19N5O2 — CID 7392182
(4aR,7aS)-5,7-dimethyl-4a,7a-diphenyl-2,4-dihydro-1H-imidazo[4,5-e][1,2,4]triazine-3,6-dione (PubChem CID 7392182) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (4aR,7aS)-5,7-dimethyl-4a,7a-diphenyl-2,4-dihydro-1H-imidazo[4,5-e][1,2,4]triazine-3,6-dione.
| Compound Name | (4aR,7aS)-5,7-dimethyl-4a,7a-diphenyl-2,4-dihydro-1H-imidazo[4,5-e][1,2,4]triazine-3,6-dione |
|---|---|
| PubChem CID | 7392182 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | (4aR,7aS)-5,7-dimethyl-4a,7a-diphenyl-2,4-dihydro-1H-imidazo[4,5-e][1,2,4]triazine-3,6-dione |
| SMILES | CN1C(=O)N(C)[C@@]2(c3ccccc3)NC(=O)NN[C@]12c1ccccc1 |
| InChI | InChI=1S/C18H19N5O2/c1-22-16(25)23(2)18(14-11-7-4-8-12-14)17(22,19-15(24)20-21-18)13-9-5-3-6-10-13/h3-12,21H,1-2H3,(H2,19,20,24)/t17-,18-/m1/s1 |
| InChIKey | BZMQSOMCHOSZCM-QZTJIDSGSA-N |
| XLogP | 1.51 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |