C10H18N4O3+2 — CID 7393074
5-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 7393074) has the molecular formula C10H18N4O3+2 and a molecular weight of 242.28 g/mol. Its IUPAC name is 5-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7393074 |
| Molecular Formula | C10H18N4O3+2 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 5-[(4-methylpiperazine-1,4-diium-1-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | C[NH+]1CC[NH+](CC2C(=O)NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C10H16N4O3/c1-13-2-4-14(5-3-13)6-7-8(15)11-10(17)12-9(7)16/h7H,2-6H2,1H3,(H2,11,12,15,16,17)/p+2 |
| InChIKey | GUWDDZAUSUURIU-UHFFFAOYSA-P |
| XLogP | -4.62 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|