C12H24N2O — CID 7393137
(3S,5S)-N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide (PubChem CID 7393137) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is (3S,5S)-N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide.
| Compound Name | (3S,5S)-N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 7393137 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | (3S,5S)-N,N-diethyl-3,5-dimethylpiperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1C[C@@H](C)C[C@H](C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-5-13(6-2)12(15)14-8-10(3)7-11(4)9-14/h10-11H,5-9H2,1-4H3/t10-,11-/m0/s1 |
| InChIKey | GTVUMRKCLOXJLX-QWRGUYRKSA-N |
| XLogP | 2.43 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |