C19H26O3 — CID 739331
3,3,6,6,9,9-hexamethyl-2,4,5,7-tetrahydroxanthene-1,8-dione (PubChem CID 739331) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 3,3,6,6,9,9-hexamethyl-2,4,5,7-tetrahydroxanthene-1,8-dione.
| Compound Name | 3,3,6,6,9,9-hexamethyl-2,4,5,7-tetrahydroxanthene-1,8-dione |
|---|---|
| PubChem CID | 739331 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 3,3,6,6,9,9-hexamethyl-2,4,5,7-tetrahydroxanthene-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC1=C(C(=O)CC(C)(C)C1)C2(C)C |
| InChI | InChI=1S/C19H26O3/c1-17(2)7-11(20)15-13(9-17)22-14-10-18(3,4)8-12(21)16(14)19(15,5)6/h7-10H2,1-6H3 |
| InChIKey | MTFQHJMVAIIKBN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |