C11H16N2O4S — CID 7393332
(2S)-2-[(2-methoxy-5-methylphenyl)sulfonylamino]propanamide (PubChem CID 7393332) has the molecular formula C11H16N2O4S and a molecular weight of 272.33 g/mol. Its IUPAC name is (2S)-2-[(2-methoxy-5-methylphenyl)sulfonylamino]propanamide.
| Compound Name | (2S)-2-[(2-methoxy-5-methylphenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 7393332 |
| Molecular Formula | C11H16N2O4S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (2S)-2-[(2-methoxy-5-methylphenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N[C@@H](C)C(N)=O |
| InChI | InChI=1S/C11H16N2O4S/c1-7-4-5-9(17-3)10(6-7)18(15,16)13-8(2)11(12)14/h4-6,8,13H,1-3H3,(H2,12,14)/t8-/m0/s1 |
| InChIKey | ZVNSTCFVJPITGX-QMMMGPOBSA-N |
| XLogP | 0.16 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |