About 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone
1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone (PubChem CID 739371) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 739371 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone |
| SMILES | Cc1ccc(C(=O)Cn2cncn2)cc1 |
| InChI | InChI=1S/C11H11N3O/c1-9-2-4-10(5-3-9)11(15)6-14-8-12-7-13-14/h2-5,7-8H,6H2,1H3 |
| InChIKey | ZFWAVFITNQYLMB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone?
The IUPAC name of 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone (CID 739371) is 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone is Cc1ccc(C(=O)Cn2cncn2)cc1.
What is the InChIKey of 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone?
The InChIKey is ZFWAVFITNQYLMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c1-9-2-4-10(5-3-9)11(15)6-14-8-12-7-13-14/h2-5,7-8H,6H2,1H3.
What are the key properties of 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone?
1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone has a molecular weight of 201.23 g/mol, XLogP of 1.47, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methylphenyl)-2-(1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 739371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).