C13H13N7 — CID 7394460
N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine (PubChem CID 7394460) has the molecular formula C13H13N7 and a molecular weight of 267.30 g/mol. Its IUPAC name is N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine.
| Compound Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
|---|---|
| PubChem CID | 7394460 |
| Molecular Formula | C13H13N7 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | N-[(E)-1-(4-aminophenyl)ethylideneamino]-[1,2,4]triazolo[4,3-b]pyridazin-6-amine |
| SMILES | C/C(=N\Nc1ccc2nncn2n1)c1ccc(N)cc1 |
| InChI | InChI=1S/C13H13N7/c1-9(10-2-4-11(14)5-3-10)16-17-12-6-7-13-18-15-8-20(13)19-12/h2-8H,14H2,1H3,(H,17,19)/b16-9+ |
| InChIKey | PYWWLIFUFXKXNV-CXUHLZMHSA-N |
| XLogP | 1.54 |
| TPSA | 93.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|