C19H20N2O4S — CID 7395864
[(3S)-2-ethyl-4-(2-hydroxyethylimino)-1,1-dioxo-3H-1lambda6,2-benzothiazin-3-yl]-phenylmethanone (PubChem CID 7395864) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is [(3S)-2-ethyl-4-(2-hydroxyethylimino)-1,1-dioxo-3H-1lambda6,2-benzothiazin-3-yl]-phenylmethanone.
| Compound Name | [(3S)-2-ethyl-4-(2-hydroxyethylimino)-1,1-dioxo-3H-1lambda6,2-benzothiazin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7395864 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | [(3S)-2-ethyl-4-(2-hydroxyethylimino)-1,1-dioxo-3H-1lambda6,2-benzothiazin-3-yl]-phenylmethanone |
| SMILES | CCN1[C@H](C(=O)c2ccccc2)/C(=N/CCO)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C19H20N2O4S/c1-2-21-18(19(23)14-8-4-3-5-9-14)17(20-12-13-22)15-10-6-7-11-16(15)26(21,24)25/h3-11,18,22H,2,12-13H2,1H3/b20-17+/t18-/m0/s1 |
| InChIKey | AOLUXOZOEIIXFD-ONZPZFSWSA-N |
| XLogP | 1.74 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|