C16H13Cl2NOS — CID 7396529
[(2R)-2-(2,4-dichlorophenyl)-1,3-thiazolidin-3-yl]-phenylmethanone (PubChem CID 7396529) has the molecular formula C16H13Cl2NOS and a molecular weight of 338.26 g/mol. Its IUPAC name is [(2R)-2-(2,4-dichlorophenyl)-1,3-thiazolidin-3-yl]-phenylmethanone.
| Compound Name | [(2R)-2-(2,4-dichlorophenyl)-1,3-thiazolidin-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 7396529 |
| Molecular Formula | C16H13Cl2NOS |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.01 |
| IUPAC Name | [(2R)-2-(2,4-dichlorophenyl)-1,3-thiazolidin-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCS[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NOS/c17-12-6-7-13(14(18)10-12)16-19(8-9-21-16)15(20)11-4-2-1-3-5-11/h1-7,10,16H,8-9H2/t16-/m1/s1 |
| InChIKey | GGJVRPVWWMMRSK-MRXNPFEDSA-N |
| XLogP | 4.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |