C21H32N6O2+2 — CID 7396975
1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine-1,4-diium (PubChem CID 7396975) has the molecular formula C21H32N6O2+2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine-1,4-diium.
| Compound Name | 1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 7396975 |
| Molecular Formula | C21H32N6O2+2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 1-[(1S)-1-[1-(1,3-benzodioxol-5-ylmethyl)tetrazol-5-yl]pentyl]-4-prop-2-enylpiperazine-1,4-diium |
| SMILES | C=CC[NH+]1CC[NH+]([C@@H](CCCC)c2nnnn2Cc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C21H30N6O2/c1-3-5-6-18(26-12-10-25(9-4-2)11-13-26)21-22-23-24-27(21)15-17-7-8-19-20(14-17)29-16-28-19/h4,7-8,14,18H,2-3,5-6,9-13,15-16H2,1H3/p+2/t18-/m0/s1 |
| InChIKey | BVRPWQRCVPLBAT-SFHVURJKSA-P |
| XLogP | -0.35 |
| TPSA | 70.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|