C9H4Cl2O2S — CID 739884
3,6-dichloro-1-benzothiophene-2-carboxylic acid (PubChem CID 739884) has the molecular formula C9H4Cl2O2S and a molecular weight of 247.10 g/mol. Its IUPAC name is 3,6-dichloro-1-benzothiophene-2-carboxylic acid.
| Compound Name | 3,6-dichloro-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 739884 |
| Molecular Formula | C9H4Cl2O2S |
| Molecular Weight | 247.10 g/mol |
| Exact Mass | 245.93 |
| IUPAC Name | 3,6-dichloro-1-benzothiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C9H4Cl2O2S/c10-4-1-2-5-6(3-4)14-8(7(5)11)9(12)13/h1-3H,(H,12,13) |
| InChIKey | AAHPIJMQJAZYTM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.10 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |