About N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide
N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide (PubChem CID 739902) has the molecular formula C14H8Cl2N2OS
and a molecular weight of 323.20 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide.
Molecular Properties
| Compound Name | N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide |
| PubChem CID | 739902 |
| Molecular Formula | C14H8Cl2N2OS |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H8Cl2N2OS/c15-8-5-6-9(10(16)7-8)13(19)18-14-17-11-3-1-2-4-12(11)20-14/h1-7H,(H,17,18,19) |
| InChIKey | IYKYUDCCMHWRAT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide?
The IUPAC name of N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide (CID 739902) is N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide.
What is the SMILES notation for N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide?
The canonical SMILES for N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide is O=C(Nc1nc2ccccc2s1)c1ccc(Cl)cc1Cl.
What is the InChIKey of N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide?
The InChIKey is IYKYUDCCMHWRAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Cl2N2OS/c15-8-5-6-9(10(16)7-8)13(19)18-14-17-11-3-1-2-4-12(11)20-14/h1-7H,(H,17,18,19).
What are the key properties of N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide?
N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide has a molecular weight of 323.20 g/mol, XLogP of 4.86, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-benzothiazol-2-yl)-2,4-dichlorobenzamide is sourced from PubChem (CID 739902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).