About (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate
(1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate (PubChem CID 7399927) has the molecular formula C19H17NO5S
and a molecular weight of 371.41 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate.
Molecular Properties
| Compound Name | (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
| PubChem CID | 7399927 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate |
| SMILES | Cc1cc(C(=O)CCC(=O)OCN2C(=O)c3ccccc3C2=O)c(C)s1 |
| InChI | InChI=1S/C19H17NO5S/c1-11-9-15(12(2)26-11)16(21)7-8-17(22)25-10-20-18(23)13-5-3-4-6-14(13)19(20)24/h3-6,9H,7-8,10H2,1-2H3 |
| InChIKey | GGPORHUVPRKXRX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
The IUPAC name of (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate (CID 7399927) is (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate.
What is the SMILES notation for (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
The canonical SMILES for (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate is Cc1cc(C(=O)CCC(=O)OCN2C(=O)c3ccccc3C2=O)c(C)s1.
What is the InChIKey of (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
The InChIKey is GGPORHUVPRKXRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5S/c1-11-9-15(12(2)26-11)16(21)7-8-17(22)25-10-20-18(23)13-5-3-4-6-14(13)19(20)24/h3-6,9H,7-8,10H2,1-2H3.
What are the key properties of (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate?
(1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate has a molecular weight of 371.41 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxoisoindol-2-yl)methyl 4-(2,5-dimethylthiophen-3-yl)-4-oxobutanoate is sourced from PubChem (CID 7399927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).