C43H73N7O8 — CID 74000100
3,6,15,21-tetra(butan-2-yl)-18-[1-(2-methylbut-3-en-2-yloxy)ethyl]-1,4,7,13,16,19,22-heptazatricyclo[22.3.0.09,13]heptacosane-2,5,8,14,17,20,23-heptone (PubChem CID 74000100) has the molecular formula C43H73N7O8 and a molecular weight of 816.10 g/mol. Its IUPAC name is 3,6,15,21-tetra(butan-2-yl)-18-[1-(2-methylbut-3-en-2-yloxy)ethyl]-1,4,7,13,16,19,22-heptazatricyclo[22.3.0.09,13]heptacosane-2,5,8,14,17,20,23-heptone.
| Compound Name | 3,6,15,21-tetra(butan-2-yl)-18-[1-(2-methylbut-3-en-2-yloxy)ethyl]-1,4,7,13,16,19,22-heptazatricyclo[22.3.0.09,13]heptacosane-2,5,8,14,17,20,23-heptone |
|---|---|
| PubChem CID | 74000100 |
| Molecular Formula | C43H73N7O8 |
| Molecular Weight | 816.10 g/mol |
| Exact Mass | 815.55 |
| IUPAC Name | 3,6,15,21-tetra(butan-2-yl)-18-[1-(2-methylbut-3-en-2-yloxy)ethyl]-1,4,7,13,16,19,22-heptazatricyclo[22.3.0.09,13]heptacosane-2,5,8,14,17,20,23-heptone |
| SMILES | C=CC(C)(C)OC(C)C1NC(=O)C(C(C)CC)NC(=O)C2CCCN2C(=O)C(C(C)CC)NC(=O)C(C(C)CC)NC(=O)C2CCCN2C(=O)C(C(C)CC)NC1=O |
| InChI | InChI=1S/C43H73N7O8/c1-13-24(6)31-38(53)46-33(26(8)15-3)41(56)49-22-18-21-30(49)37(52)45-32(25(7)14-2)39(54)48-35(28(10)58-43(11,12)17-5)40(55)47-34(27(9)16-4)42(57)50-23-19-20-29(50)36(51)44-31/h17,24-35H,5,13-16,18-23H2,1-4,6-12H3,(H,44,51)(H,45,52)(H,46,53)(H,47,55)(H,48,54) |
| InChIKey | RIMDKZLFKQEDBI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 195.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 816.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|