C15H20Br2O3 — CID 74000128
12-bromo-5-(3-bromopropa-1,2-dienyl)-9-ethyl-4,8,13-trioxatricyclo[8.2.1.03,7]tridecane (PubChem CID 74000128) has the molecular formula C15H20Br2O3 and a molecular weight of 408.13 g/mol. Its IUPAC name is 12-bromo-5-(3-bromopropa-1,2-dienyl)-9-ethyl-4,8,13-trioxatricyclo[8.2.1.03,7]tridecane.
| Compound Name | 12-bromo-5-(3-bromopropa-1,2-dienyl)-9-ethyl-4,8,13-trioxatricyclo[8.2.1.03,7]tridecane |
|---|---|
| PubChem CID | 74000128 |
| Molecular Formula | C15H20Br2O3 |
| Molecular Weight | 408.13 g/mol |
| Exact Mass | 405.98 |
| IUPAC Name | 12-bromo-5-(3-bromopropa-1,2-dienyl)-9-ethyl-4,8,13-trioxatricyclo[8.2.1.03,7]tridecane |
| SMILES | CCC1OC2CC(C=C=CBr)OC2CC2OC1CC2Br |
| InChI | InChI=1S/C15H20Br2O3/c1-2-11-14-7-10(17)12(20-14)8-15-13(19-11)6-9(18-15)4-3-5-16/h4-5,9-15H,2,6-8H2,1H3 |
| InChIKey | UUENBIBWOYMCPA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|