About [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (PubChem CID 7400282) has the molecular formula C18H15FN2O5
and a molecular weight of 358.33 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| PubChem CID | 7400282 |
| Molecular Formula | C18H15FN2O5 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate |
| SMILES | O=C(COC(=O)Cn1c(=O)oc2ccccc21)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O5/c19-13-7-5-12(6-8-13)9-20-16(22)11-25-17(23)10-21-14-3-1-2-4-15(14)26-18(21)24/h1-8H,9-11H2,(H,20,22) |
| InChIKey | OMSSOLFFPUYDAX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
The IUPAC name of [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate (CID 7400282) is [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate.
What is the SMILES notation for [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
The canonical SMILES for [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate is O=C(COC(=O)Cn1c(=O)oc2ccccc21)NCc1ccc(F)cc1.
What is the InChIKey of [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
The InChIKey is OMSSOLFFPUYDAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15FN2O5/c19-13-7-5-12(6-8-13)9-20-16(22)11-25-17(23)10-21-14-3-1-2-4-15(14)26-18(21)24/h1-8H,9-11H2,(H,20,22).
What are the key properties of [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate?
[2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate has a molecular weight of 358.33 g/mol, XLogP of 1.59, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-fluorophenyl)methylamino]-2-oxoethyl] 2-(2-oxo-1,3-benzoxazol-3-yl)acetate is sourced from PubChem (CID 7400282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).