C44H50N4O2 — CID 74006497
2,5-bis[2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzene-1,4-dicarbonitrile (PubChem CID 74006497) has the molecular formula C44H50N4O2 and a molecular weight of 666.91 g/mol. Its IUPAC name is 2,5-bis[2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzene-1,4-dicarbonitrile.
| Compound Name | 2,5-bis[2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzene-1,4-dicarbonitrile |
|---|---|
| PubChem CID | 74006497 |
| Molecular Formula | C44H50N4O2 |
| Molecular Weight | 666.91 g/mol |
| Exact Mass | 666.39 |
| IUPAC Name | 2,5-bis[2-(6-hydroxy-4,4,10,10-tetramethyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)ethenyl]benzene-1,4-dicarbonitrile |
| SMILES | CC1(C)CCN2CCC(C)(C)c3c(O)c(C=Cc4cc(C#N)c(C=Cc5cc6c7c(c5O)C(C)(C)CCN7CCC6(C)C)cc4C#N)cc1c32 |
| InChI | InChI=1S/C44H50N4O2/c1-41(2)13-17-47-19-15-43(5,6)35-37(47)33(41)23-29(39(35)49)11-9-27-21-32(26-46)28(22-31(27)25-45)10-12-30-24-34-38-36(40(30)50)44(7,8)16-20-48(38)18-14-42(34,3)4/h9-12,21-24,49-50H,13-20H2,1-8H3 |
| InChIKey | PFGWFQKUPZGKIL-UHFFFAOYSA-N |
| XLogP | 9.52 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.91 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|