About CID 74007392
CID 74007392 (PubChem CID 74007392) has the molecular formula C27H40N2O6
and a molecular weight of 488.63 g/mol.
Molecular Properties
| Compound Name | CID 74007392 |
| PubChem CID | 74007392 |
| Molecular Formula | C27H40N2O6 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(OC(=O)C23C4CC5C(C42)C53C(=O)OC2CC(C)(C)N([O])C(C)(C)C2)CC(C)(C)N1[O] |
| InChI | InChI=1S/C27H40N2O6/c1-22(2)10-14(11-23(3,4)28(22)32)34-20(30)26-16-9-17-19(18(16)26)27(17,26)21(31)35-15-12-24(5,6)29(33)25(7,8)13-15/h14-19H,9-13H2,1-8H3 |
| InChIKey | MRLKZJPRCHVXQO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 98.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 74007392 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 74007392?
The IUPAC name of CID 74007392 (CID 74007392) is not available.
What is the SMILES notation for CID 74007392?
The canonical SMILES for CID 74007392 is CC1(C)CC(OC(=O)C23C4CC5C(C42)C53C(=O)OC2CC(C)(C)N([O])C(C)(C)C2)CC(C)(C)N1[O].
What is the InChIKey of CID 74007392?
The InChIKey is MRLKZJPRCHVXQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H40N2O6/c1-22(2)10-14(11-23(3,4)28(22)32)34-20(30)26-16-9-17-19(18(16)26)27(17,26)21(31)35-15-12-24(5,6)29(33)25(7,8)13-15/h14-19H,9-13H2,1-8H3.
What are the key properties of CID 74007392?
CID 74007392 has a molecular weight of 488.63 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 74007392 is sourced from PubChem (CID 74007392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).