C30H24N4O2 — CID 74009411
4-[5-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-diphenylpyrazol-3-one (PubChem CID 74009411) has the molecular formula C30H24N4O2 and a molecular weight of 472.55 g/mol. Its IUPAC name is 4-[5-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-diphenylpyrazol-3-one.
| Compound Name | 4-[5-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-diphenylpyrazol-3-one |
|---|---|
| PubChem CID | 74009411 |
| Molecular Formula | C30H24N4O2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 4-[5-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-diphenylpyrazol-3-one |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1C=CC=CC=C1C(=O)N(c2ccccc2)N=C1c1ccccc1 |
| InChI | InChI=1S/C30H24N4O2/c1-22-26(29(35)33(31-22)24-16-8-3-9-17-24)20-12-5-13-21-27-28(23-14-6-2-7-15-23)32-34(30(27)36)25-18-10-4-11-19-25/h2-21,31H,1H3 |
| InChIKey | AROGLIZBLPYOBH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|