3-methylnona-2,4-diene-2-sulfonic acid

C10H18O3S — CID 74010618

IUPAC3-methylnona-2,4-diene-2-sulfonic acid
SMILESCCCCC=CC(C)=C(C)S(=O)(=O)O
InChIInChI=1S/C10H18O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h7-8H,4-6H2,1-3H3,(H,11,12,13)
InChIKeyOMUXQEBSSIZFAX-UHFFFAOYSA-N
MW218.32 g/mol
LogP2.91
Rot. Bonds5

About 3-methylnona-2,4-diene-2-sulfonic acid

3-methylnona-2,4-diene-2-sulfonic acid (PubChem CID 74010618) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is 3-methylnona-2,4-diene-2-sulfonic acid.

Molecular Properties

Compound Name3-methylnona-2,4-diene-2-sulfonic acid
PubChem CID74010618
Molecular FormulaC10H18O3S
Molecular Weight218.32 g/mol
Exact Mass218.10
IUPAC Name3-methylnona-2,4-diene-2-sulfonic acid
SMILESCCCCC=CC(C)=C(C)S(=O)(=O)O
InChIInChI=1S/C10H18O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h7-8H,4-6H2,1-3H3,(H,11,12,13)
InChIKeyOMUXQEBSSIZFAX-UHFFFAOYSA-N
XLogP2.91
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.32
LogP ≤ 52.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 3-methylnona-2,4-diene-2-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-methylnona-2,4-diene-2-sulfonic acid?
The IUPAC name of 3-methylnona-2,4-diene-2-sulfonic acid (CID 74010618) is 3-methylnona-2,4-diene-2-sulfonic acid.
What is the SMILES notation for 3-methylnona-2,4-diene-2-sulfonic acid?
The canonical SMILES for 3-methylnona-2,4-diene-2-sulfonic acid is CCCCC=CC(C)=C(C)S(=O)(=O)O.
What is the InChIKey of 3-methylnona-2,4-diene-2-sulfonic acid?
The InChIKey is OMUXQEBSSIZFAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O3S/c1-4-5-6-7-8-9(2)10(3)14(11,12)13/h7-8H,4-6H2,1-3H3,(H,11,12,13).
What are the key properties of 3-methylnona-2,4-diene-2-sulfonic acid?
3-methylnona-2,4-diene-2-sulfonic acid has a molecular weight of 218.32 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylnona-2,4-diene-2-sulfonic acid is sourced from PubChem (CID 74010618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).